C23H40O9 — CID 87834821
1-O-(2-butoxyethyl) 6-O-[2,3-di(butanoyloxy)propyl] hexanedioate (PubChem CID 87834821) has the molecular formula C23H40O9 and a molecular weight of 460.56 g/mol. Its IUPAC name is 1-O-(2-butoxyethyl) 6-O-[2,3-di(butanoyloxy)propyl] hexanedioate.
| Compound Name | 1-O-(2-butoxyethyl) 6-O-[2,3-di(butanoyloxy)propyl] hexanedioate |
|---|---|
| PubChem CID | 87834821 |
| Molecular Formula | C23H40O9 |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 1-O-(2-butoxyethyl) 6-O-[2,3-di(butanoyloxy)propyl] hexanedioate |
| SMILES | CCCCOCCOC(=O)CCCCC(=O)OCC(COC(=O)CCC)OC(=O)CCC |
| InChI | InChI=1S/C23H40O9/c1-4-7-14-28-15-16-29-21(25)12-8-9-13-22(26)31-18-19(32-23(27)11-6-3)17-30-20(24)10-5-2/h19H,4-18H2,1-3H3 |
| InChIKey | WSQNCJLBJCAKCF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|