C11H21O8P — CID 118370005
(2-butanoyloxy-3-phosphonooxypropyl) butanoate (PubChem CID 118370005) has the molecular formula C11H21O8P and a molecular weight of 312.26 g/mol. Its IUPAC name is (2-butanoyloxy-3-phosphonooxypropyl) butanoate.
| Compound Name | (2-butanoyloxy-3-phosphonooxypropyl) butanoate |
|---|---|
| PubChem CID | 118370005 |
| Molecular Formula | C11H21O8P |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (2-butanoyloxy-3-phosphonooxypropyl) butanoate |
| SMILES | CCCC(=O)OCC(COP(=O)(O)O)OC(=O)CCC |
| InChI | InChI=1S/C11H21O8P/c1-3-5-10(12)17-7-9(8-18-20(14,15)16)19-11(13)6-4-2/h9H,3-8H2,1-2H3,(H2,14,15,16) |
| InChIKey | RHPFHHIXMKPONY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|