C8H17O7P — CID 59943573
(2-methoxy-3-phosphonooxypropyl) butanoate (PubChem CID 59943573) has the molecular formula C8H17O7P and a molecular weight of 256.19 g/mol. Its IUPAC name is (2-methoxy-3-phosphonooxypropyl) butanoate.
| Compound Name | (2-methoxy-3-phosphonooxypropyl) butanoate |
|---|---|
| PubChem CID | 59943573 |
| Molecular Formula | C8H17O7P |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (2-methoxy-3-phosphonooxypropyl) butanoate |
| SMILES | CCCC(=O)OCC(COP(=O)(O)O)OC |
| InChI | InChI=1S/C8H17O7P/c1-3-4-8(9)14-5-7(13-2)6-15-16(10,11)12/h7H,3-6H2,1-2H3,(H2,10,11,12) |
| InChIKey | IXJTVHOSQLJGSS-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|