C18H32O9 — CID 18724217
2,3-bis(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate (PubChem CID 18724217) has the molecular formula C18H32O9 and a molecular weight of 392.45 g/mol. Its IUPAC name is 2,3-bis(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate.
| Compound Name | 2,3-bis(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate |
|---|---|
| PubChem CID | 18724217 |
| Molecular Formula | C18H32O9 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 2,3-bis(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate |
| SMILES | CCC(O)CC(=O)OCC(COC(=O)CC(O)CC)OC(=O)CC(O)CC |
| InChI | InChI=1S/C18H32O9/c1-4-12(19)7-16(22)25-10-15(27-18(24)9-14(21)6-3)11-26-17(23)8-13(20)5-2/h12-15,19-21H,4-11H2,1-3H3 |
| InChIKey | OVEVUHUPHHFQPA-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|