C21H40O11 — CID 160689312
methyl 3-hydroxybutanoate;methyl 3-(3-hydroxybutanoyloxy)pentanoate;methyl 3-hydroxypentanoate (PubChem CID 160689312) has the molecular formula C21H40O11 and a molecular weight of 468.54 g/mol. Its IUPAC name is methyl 3-hydroxybutanoate;methyl 3-(3-hydroxybutanoyloxy)pentanoate;methyl 3-hydroxypentanoate.
| Compound Name | methyl 3-hydroxybutanoate;methyl 3-(3-hydroxybutanoyloxy)pentanoate;methyl 3-hydroxypentanoate |
|---|---|
| PubChem CID | 160689312 |
| Molecular Formula | C21H40O11 |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | methyl 3-hydroxybutanoate;methyl 3-(3-hydroxybutanoyloxy)pentanoate;methyl 3-hydroxypentanoate |
| SMILES | CCC(CC(=O)OC)OC(=O)CC(C)O.CCC(O)CC(=O)OC.COC(=O)CC(C)O |
| InChI | InChI=1S/C10H18O5.C6H12O3.C5H10O3/c1-4-8(6-9(12)14-3)15-10(13)5-7(2)11;1-3-5(7)4-6(8)9-2;1-4(6)3-5(7)8-2/h7-8,11H,4-6H2,1-3H3;5,7H,3-4H2,1-2H3;4,6H,3H2,1-2H3 |
| InChIKey | RPEVHACCACJKPA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|