About 2-(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate
2-(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate (PubChem CID 58301431) has the molecular formula C13H24O6
and a molecular weight of 276.33 g/mol. Its IUPAC name is 2-(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate.
Molecular Properties
| Compound Name | 2-(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate |
| PubChem CID | 58301431 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate |
| SMILES | CCC(O)CC(=O)OCC(C)OC(=O)CC(O)CC |
| InChI | InChI=1S/C13H24O6/c1-4-10(14)6-12(16)18-8-9(3)19-13(17)7-11(15)5-2/h9-11,14-15H,4-8H2,1-3H3 |
| InChIKey | MBGWSTQARRKGSG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate?
The IUPAC name of 2-(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate (CID 58301431) is 2-(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate.
What is the SMILES notation for 2-(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate?
The canonical SMILES for 2-(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate is CCC(O)CC(=O)OCC(C)OC(=O)CC(O)CC.
What is the InChIKey of 2-(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate?
The InChIKey is MBGWSTQARRKGSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O6/c1-4-10(14)6-12(16)18-8-9(3)19-13(17)7-11(15)5-2/h9-11,14-15H,4-8H2,1-3H3.
What are the key properties of 2-(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate?
2-(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate has a molecular weight of 276.33 g/mol, XLogP of 0.78, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxypentanoyloxy)propyl 3-hydroxypentanoate is sourced from PubChem (CID 58301431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).