About 2-[2-[2-(3-sulfanylbutanoyloxy)propoxy]propoxy]propyl 3-sulfanylbutanoate
2-[2-[2-(3-sulfanylbutanoyloxy)propoxy]propoxy]propyl 3-sulfanylbutanoate (PubChem CID 87066127) has the molecular formula C17H32O6S2
and a molecular weight of 396.57 g/mol. Its IUPAC name is 2-[2-[2-(3-sulfanylbutanoyloxy)propoxy]propoxy]propyl 3-sulfanylbutanoate.
Molecular Properties
| Compound Name | 2-[2-[2-(3-sulfanylbutanoyloxy)propoxy]propoxy]propyl 3-sulfanylbutanoate |
| PubChem CID | 87066127 |
| Molecular Formula | C17H32O6S2 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 2-[2-[2-(3-sulfanylbutanoyloxy)propoxy]propoxy]propyl 3-sulfanylbutanoate |
| SMILES | CC(S)CC(=O)OCC(C)OCC(C)OCC(C)OC(=O)CC(C)S |
| InChI | InChI=1S/C17H32O6S2/c1-11(21-10-13(3)23-17(19)7-15(5)25)8-20-12(2)9-22-16(18)6-14(4)24/h11-15,24-25H,6-10H2,1-5H3 |
| InChIKey | CVLANMBYFDVCPI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 71.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-(3-sulfanylbutanoyloxy)propoxy]propoxy]propyl 3-sulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(3-sulfanylbutanoyloxy)propoxy]propoxy]propyl 3-sulfanylbutanoate?
The IUPAC name of 2-[2-[2-(3-sulfanylbutanoyloxy)propoxy]propoxy]propyl 3-sulfanylbutanoate (CID 87066127) is 2-[2-[2-(3-sulfanylbutanoyloxy)propoxy]propoxy]propyl 3-sulfanylbutanoate.
What is the SMILES notation for 2-[2-[2-(3-sulfanylbutanoyloxy)propoxy]propoxy]propyl 3-sulfanylbutanoate?
The canonical SMILES for 2-[2-[2-(3-sulfanylbutanoyloxy)propoxy]propoxy]propyl 3-sulfanylbutanoate is CC(S)CC(=O)OCC(C)OCC(C)OCC(C)OC(=O)CC(C)S.
What is the InChIKey of 2-[2-[2-(3-sulfanylbutanoyloxy)propoxy]propoxy]propyl 3-sulfanylbutanoate?
The InChIKey is CVLANMBYFDVCPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O6S2/c1-11(21-10-13(3)23-17(19)7-15(5)25)8-20-12(2)9-22-16(18)6-14(4)24/h11-15,24-25H,6-10H2,1-5H3.
What are the key properties of 2-[2-[2-(3-sulfanylbutanoyloxy)propoxy]propoxy]propyl 3-sulfanylbutanoate?
2-[2-[2-(3-sulfanylbutanoyloxy)propoxy]propoxy]propyl 3-sulfanylbutanoate has a molecular weight of 396.57 g/mol, XLogP of 2.69, 13 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(3-sulfanylbutanoyloxy)propoxy]propoxy]propyl 3-sulfanylbutanoate is sourced from PubChem (CID 87066127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).