C15H28O8 — CID 87122386
2-[2-[2-(2-hydroxypropanoyloxy)propoxy]propoxy]propyl 2-hydroxypropanoate (PubChem CID 87122386) has the molecular formula C15H28O8 and a molecular weight of 336.38 g/mol. Its IUPAC name is 2-[2-[2-(2-hydroxypropanoyloxy)propoxy]propoxy]propyl 2-hydroxypropanoate.
| Compound Name | 2-[2-[2-(2-hydroxypropanoyloxy)propoxy]propoxy]propyl 2-hydroxypropanoate |
|---|---|
| PubChem CID | 87122386 |
| Molecular Formula | C15H28O8 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-[2-[2-(2-hydroxypropanoyloxy)propoxy]propoxy]propyl 2-hydroxypropanoate |
| SMILES | CC(COC(=O)C(C)O)OCC(C)OCC(C)OC(=O)C(C)O |
| InChI | InChI=1S/C15H28O8/c1-9(21-8-11(3)23-15(19)13(5)17)6-20-10(2)7-22-14(18)12(4)16/h9-13,16-17H,6-8H2,1-5H3 |
| InChIKey | AVNAGUVUUDPPJP-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |