C23H46O8 — CID 58444916
2-[2-[2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propoxy]propoxy]propyl 2-methylbutanoate (PubChem CID 58444916) has the molecular formula C23H46O8 and a molecular weight of 450.61 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propoxy]propoxy]propyl 2-methylbutanoate.
| Compound Name | 2-[2-[2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propoxy]propoxy]propyl 2-methylbutanoate |
|---|---|
| PubChem CID | 58444916 |
| Molecular Formula | C23H46O8 |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | 2-[2-[2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propoxy]propoxy]propyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCC(C)OCC(C)OCC(C)OCC(C)OCC(C)OCC(C)O |
| InChI | InChI=1S/C23H46O8/c1-9-16(2)23(25)31-15-22(8)30-14-21(7)29-13-20(6)28-12-19(5)27-11-18(4)26-10-17(3)24/h16-22,24H,9-15H2,1-8H3 |
| InChIKey | BQNWRWNFLWZEBZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |