About 2-(2-methylpropoxy)propyl 2-methylbutanoate
2-(2-methylpropoxy)propyl 2-methylbutanoate (PubChem CID 174484897) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-(2-methylpropoxy)propyl 2-methylbutanoate.
Molecular Properties
| Compound Name | 2-(2-methylpropoxy)propyl 2-methylbutanoate |
| PubChem CID | 174484897 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 2-(2-methylpropoxy)propyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCC(C)OCC(C)C |
| InChI | InChI=1S/C12H24O3/c1-6-10(4)12(13)15-8-11(5)14-7-9(2)3/h9-11H,6-8H2,1-5H3 |
| InChIKey | WGUXUWSJLUEAMK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-methylpropoxy)propyl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropoxy)propyl 2-methylbutanoate?
The IUPAC name of 2-(2-methylpropoxy)propyl 2-methylbutanoate (CID 174484897) is 2-(2-methylpropoxy)propyl 2-methylbutanoate.
What is the SMILES notation for 2-(2-methylpropoxy)propyl 2-methylbutanoate?
The canonical SMILES for 2-(2-methylpropoxy)propyl 2-methylbutanoate is CCC(C)C(=O)OCC(C)OCC(C)C.
What is the InChIKey of 2-(2-methylpropoxy)propyl 2-methylbutanoate?
The InChIKey is WGUXUWSJLUEAMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3/c1-6-10(4)12(13)15-8-11(5)14-7-9(2)3/h9-11H,6-8H2,1-5H3.
What are the key properties of 2-(2-methylpropoxy)propyl 2-methylbutanoate?
2-(2-methylpropoxy)propyl 2-methylbutanoate has a molecular weight of 216.32 g/mol, XLogP of 2.64, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropoxy)propyl 2-methylbutanoate is sourced from PubChem (CID 174484897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).