C16H34O7 — CID 158412024
2-(2-ethoxypropoxy)propyl acetate;2-(2-hydroxypropoxy)propan-1-ol (PubChem CID 158412024) has the molecular formula C16H34O7 and a molecular weight of 338.44 g/mol. Its IUPAC name is 2-(2-ethoxypropoxy)propyl acetate;2-(2-hydroxypropoxy)propan-1-ol.
| Compound Name | 2-(2-ethoxypropoxy)propyl acetate;2-(2-hydroxypropoxy)propan-1-ol |
|---|---|
| PubChem CID | 158412024 |
| Molecular Formula | C16H34O7 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 2-(2-ethoxypropoxy)propyl acetate;2-(2-hydroxypropoxy)propan-1-ol |
| SMILES | CC(O)COC(C)CO.CCOC(C)COC(C)COC(C)=O |
| InChI | InChI=1S/C10H20O4.C6H14O3/c1-5-12-8(2)6-13-9(3)7-14-10(4)11;1-5(8)4-9-6(2)3-7/h8-9H,5-7H2,1-4H3;5-8H,3-4H2,1-2H3 |
| InChIKey | GZKVJZLUUUHZQS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |