C14H30O7 — CID 162146312
2-(2-ethoxyethoxy)ethyl acetate;2-(2-hydroxypropoxy)propan-1-ol (PubChem CID 162146312) has the molecular formula C14H30O7 and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)ethyl acetate;2-(2-hydroxypropoxy)propan-1-ol.
| Compound Name | 2-(2-ethoxyethoxy)ethyl acetate;2-(2-hydroxypropoxy)propan-1-ol |
|---|---|
| PubChem CID | 162146312 |
| Molecular Formula | C14H30O7 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 2-(2-ethoxyethoxy)ethyl acetate;2-(2-hydroxypropoxy)propan-1-ol |
| SMILES | CC(O)COC(C)CO.CCOCCOCCOC(C)=O |
| InChI | InChI=1S/C8H16O4.C6H14O3/c1-3-10-4-5-11-6-7-12-8(2)9;1-5(8)4-9-6(2)3-7/h3-7H2,1-2H3;5-8H,3-4H2,1-2H3 |
| InChIKey | ZKPICBNNFZSBHH-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|