C14H32O6 — CID 161457243
1-ethoxypropan-2-ol;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol (PubChem CID 161457243) has the molecular formula C14H32O6 and a molecular weight of 296.40 g/mol. Its IUPAC name is 1-ethoxypropan-2-ol;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol.
| Compound Name | 1-ethoxypropan-2-ol;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol |
|---|---|
| PubChem CID | 161457243 |
| Molecular Formula | C14H32O6 |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 1-ethoxypropan-2-ol;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol |
| SMILES | CC(O)COC(C)COC(C)CO.CCOCC(C)O |
| InChI | InChI=1S/C9H20O4.C5H12O2/c1-7(11)5-12-9(3)6-13-8(2)4-10;1-3-7-4-5(2)6/h7-11H,4-6H2,1-3H3;5-6H,3-4H2,1-2H3 |
| InChIKey | WBHXWKSETVHKJV-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |