C16H36O6 — CID 157472623
1-ethoxy-2-(2-ethoxypropoxy)propane;2-(2-hydroxypropoxy)propan-1-ol (PubChem CID 157472623) has the molecular formula C16H36O6 and a molecular weight of 324.46 g/mol. Its IUPAC name is 1-ethoxy-2-(2-ethoxypropoxy)propane;2-(2-hydroxypropoxy)propan-1-ol.
| Compound Name | 1-ethoxy-2-(2-ethoxypropoxy)propane;2-(2-hydroxypropoxy)propan-1-ol |
|---|---|
| PubChem CID | 157472623 |
| Molecular Formula | C16H36O6 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 1-ethoxy-2-(2-ethoxypropoxy)propane;2-(2-hydroxypropoxy)propan-1-ol |
| SMILES | CC(O)COC(C)CO.CCOCC(C)OCC(C)OCC |
| InChI | InChI=1S/C10H22O3.C6H14O3/c1-5-11-7-9(3)13-8-10(4)12-6-2;1-5(8)4-9-6(2)3-7/h9-10H,5-8H2,1-4H3;5-8H,3-4H2,1-2H3 |
| InChIKey | BVFKRJAFSHKGSZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |