C7H16O2 — CID 92973991
(2R)-1,2-diethoxypropane (PubChem CID 92973991) has the molecular formula C7H16O2 and a molecular weight of 132.20 g/mol. Its IUPAC name is (2R)-1,2-diethoxypropane.
| Compound Name | (2R)-1,2-diethoxypropane |
|---|---|
| PubChem CID | 92973991 |
| Molecular Formula | C7H16O2 |
| Molecular Weight | 132.20 g/mol |
| Exact Mass | 132.12 |
| IUPAC Name | (2R)-1,2-diethoxypropane |
| SMILES | CCOC[C@@H](C)OCC |
| InChI | InChI=1S/C7H16O2/c1-4-8-6-7(3)9-5-2/h7H,4-6H2,1-3H3/t7-/m1/s1 |
| InChIKey | VPBZZPOGZPKYKX-SSDOTTSWSA-N |
| XLogP | 1.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |