About 1-ethoxypropan-2-yl acetate;2-ethoxypropyl acetate;methane
1-ethoxypropan-2-yl acetate;2-ethoxypropyl acetate;methane (PubChem CID 161069991) has the molecular formula C15H32O6
and a molecular weight of 308.41 g/mol. Its IUPAC name is 1-ethoxypropan-2-yl acetate;2-ethoxypropyl acetate;methane.
Molecular Properties
| Compound Name | 1-ethoxypropan-2-yl acetate;2-ethoxypropyl acetate;methane |
| PubChem CID | 161069991 |
| Molecular Formula | C15H32O6 |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 1-ethoxypropan-2-yl acetate;2-ethoxypropyl acetate;methane |
| SMILES | C.CCOC(C)COC(C)=O.CCOCC(C)OC(C)=O |
| InChI | InChI=1S/2C7H14O3.CH4/c1-4-9-6(2)5-10-7(3)8;1-4-9-5-6(2)10-7(3)8;/h2*6H,4-5H2,1-3H3;1H4 |
| InChIKey | UENLXXGIURXZAC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-ethoxypropan-2-yl acetate;2-ethoxypropyl acetate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxypropan-2-yl acetate;2-ethoxypropyl acetate;methane?
The IUPAC name of 1-ethoxypropan-2-yl acetate;2-ethoxypropyl acetate;methane (CID 161069991) is 1-ethoxypropan-2-yl acetate;2-ethoxypropyl acetate;methane.
What is the SMILES notation for 1-ethoxypropan-2-yl acetate;2-ethoxypropyl acetate;methane?
The canonical SMILES for 1-ethoxypropan-2-yl acetate;2-ethoxypropyl acetate;methane is C.CCOC(C)COC(C)=O.CCOCC(C)OC(C)=O.
What is the InChIKey of 1-ethoxypropan-2-yl acetate;2-ethoxypropyl acetate;methane?
The InChIKey is UENLXXGIURXZAC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H14O3.CH4/c1-4-9-6(2)5-10-7(3)8;1-4-9-5-6(2)10-7(3)8;/h2*6H,4-5H2,1-3H3;1H4.
What are the key properties of 1-ethoxypropan-2-yl acetate;2-ethoxypropyl acetate;methane?
1-ethoxypropan-2-yl acetate;2-ethoxypropyl acetate;methane has a molecular weight of 308.41 g/mol, XLogP of 2.59, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxypropan-2-yl acetate;2-ethoxypropyl acetate;methane is sourced from PubChem (CID 161069991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).