About 1-ethoxypropan-2-yl acetate;1-methoxy-2-(2-methoxyethoxy)ethane
1-ethoxypropan-2-yl acetate;1-methoxy-2-(2-methoxyethoxy)ethane (PubChem CID 158068416) has the molecular formula C13H28O6
and a molecular weight of 280.36 g/mol. Its IUPAC name is 1-ethoxypropan-2-yl acetate;1-methoxy-2-(2-methoxyethoxy)ethane.
Molecular Properties
| Compound Name | 1-ethoxypropan-2-yl acetate;1-methoxy-2-(2-methoxyethoxy)ethane |
| PubChem CID | 158068416 |
| Molecular Formula | C13H28O6 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-ethoxypropan-2-yl acetate;1-methoxy-2-(2-methoxyethoxy)ethane |
| SMILES | CCOCC(C)OC(C)=O.COCCOCCOC |
| InChI | InChI=1S/C7H14O3.C6H14O3/c1-4-9-5-6(2)10-7(3)8;1-7-3-5-9-6-4-8-2/h6H,4-5H2,1-3H3;3-6H2,1-2H3 |
| InChIKey | FLNCGTCHUOSODR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxypropan-2-yl acetate;1-methoxy-2-(2-methoxyethoxy)ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxypropan-2-yl acetate;1-methoxy-2-(2-methoxyethoxy)ethane?
The IUPAC name of 1-ethoxypropan-2-yl acetate;1-methoxy-2-(2-methoxyethoxy)ethane (CID 158068416) is 1-ethoxypropan-2-yl acetate;1-methoxy-2-(2-methoxyethoxy)ethane.
What is the SMILES notation for 1-ethoxypropan-2-yl acetate;1-methoxy-2-(2-methoxyethoxy)ethane?
The canonical SMILES for 1-ethoxypropan-2-yl acetate;1-methoxy-2-(2-methoxyethoxy)ethane is CCOCC(C)OC(C)=O.COCCOCCOC.
What is the InChIKey of 1-ethoxypropan-2-yl acetate;1-methoxy-2-(2-methoxyethoxy)ethane?
The InChIKey is FLNCGTCHUOSODR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3.C6H14O3/c1-4-9-5-6(2)10-7(3)8;1-7-3-5-9-6-4-8-2/h6H,4-5H2,1-3H3;3-6H2,1-2H3.
What are the key properties of 1-ethoxypropan-2-yl acetate;1-methoxy-2-(2-methoxyethoxy)ethane?
1-ethoxypropan-2-yl acetate;1-methoxy-2-(2-methoxyethoxy)ethane has a molecular weight of 280.36 g/mol, XLogP of 1.27, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxypropan-2-yl acetate;1-methoxy-2-(2-methoxyethoxy)ethane is sourced from PubChem (CID 158068416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).