About 1-ethoxypropan-2-yl 2-(2-methoxyethylamino)acetate
1-ethoxypropan-2-yl 2-(2-methoxyethylamino)acetate (PubChem CID 103488949) has the molecular formula C10H21NO4
and a molecular weight of 219.28 g/mol. Its IUPAC name is 1-ethoxypropan-2-yl 2-(2-methoxyethylamino)acetate.
Molecular Properties
| Compound Name | 1-ethoxypropan-2-yl 2-(2-methoxyethylamino)acetate |
| PubChem CID | 103488949 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 1-ethoxypropan-2-yl 2-(2-methoxyethylamino)acetate |
| SMILES | CCOCC(C)OC(=O)CNCCOC |
| InChI | InChI=1S/C10H21NO4/c1-4-14-8-9(2)15-10(12)7-11-5-6-13-3/h9,11H,4-8H2,1-3H3 |
| InChIKey | VSRHOWLIPPECLW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxypropan-2-yl 2-(2-methoxyethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxypropan-2-yl 2-(2-methoxyethylamino)acetate?
The IUPAC name of 1-ethoxypropan-2-yl 2-(2-methoxyethylamino)acetate (CID 103488949) is 1-ethoxypropan-2-yl 2-(2-methoxyethylamino)acetate.
What is the SMILES notation for 1-ethoxypropan-2-yl 2-(2-methoxyethylamino)acetate?
The canonical SMILES for 1-ethoxypropan-2-yl 2-(2-methoxyethylamino)acetate is CCOCC(C)OC(=O)CNCCOC.
What is the InChIKey of 1-ethoxypropan-2-yl 2-(2-methoxyethylamino)acetate?
The InChIKey is VSRHOWLIPPECLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO4/c1-4-14-8-9(2)15-10(12)7-11-5-6-13-3/h9,11H,4-8H2,1-3H3.
What are the key properties of 1-ethoxypropan-2-yl 2-(2-methoxyethylamino)acetate?
1-ethoxypropan-2-yl 2-(2-methoxyethylamino)acetate has a molecular weight of 219.28 g/mol, XLogP of 0.19, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxypropan-2-yl 2-(2-methoxyethylamino)acetate is sourced from PubChem (CID 103488949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).