C9H16F3NO3 — CID 103489051
1-ethoxypropan-2-yl 2-(2,2,2-trifluoroethylamino)acetate (PubChem CID 103489051) has the molecular formula C9H16F3NO3 and a molecular weight of 243.22 g/mol. Its IUPAC name is 1-ethoxypropan-2-yl 2-(2,2,2-trifluoroethylamino)acetate.
| Compound Name | 1-ethoxypropan-2-yl 2-(2,2,2-trifluoroethylamino)acetate |
|---|---|
| PubChem CID | 103489051 |
| Molecular Formula | C9H16F3NO3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 1-ethoxypropan-2-yl 2-(2,2,2-trifluoroethylamino)acetate |
| SMILES | CCOCC(C)OC(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C9H16F3NO3/c1-3-15-5-7(2)16-8(14)4-13-6-9(10,11)12/h7,13H,3-6H2,1-2H3 |
| InChIKey | SEEYUSSLOJCSIR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |