About 1-methoxypropan-2-yl acetate;2-methoxypropyl acetate
1-methoxypropan-2-yl acetate;2-methoxypropyl acetate (PubChem CID 87233398) has the molecular formula C12H24O6
and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-methoxypropan-2-yl acetate;2-methoxypropyl acetate.
Molecular Properties
| Compound Name | 1-methoxypropan-2-yl acetate;2-methoxypropyl acetate |
| PubChem CID | 87233398 |
| Molecular Formula | C12H24O6 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1-methoxypropan-2-yl acetate;2-methoxypropyl acetate |
| SMILES | COC(C)COC(C)=O.COCC(C)OC(C)=O |
| InChI | InChI=1S/2C6H12O3/c1-5(8-3)4-9-6(2)7;1-5(4-8-3)9-6(2)7/h2*5H,4H2,1-3H3 |
| InChIKey | NVNHYMZQUYNJCB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methoxypropan-2-yl acetate;2-methoxypropyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-yl acetate;2-methoxypropyl acetate?
The IUPAC name of 1-methoxypropan-2-yl acetate;2-methoxypropyl acetate (CID 87233398) is 1-methoxypropan-2-yl acetate;2-methoxypropyl acetate.
What is the SMILES notation for 1-methoxypropan-2-yl acetate;2-methoxypropyl acetate?
The canonical SMILES for 1-methoxypropan-2-yl acetate;2-methoxypropyl acetate is COC(C)COC(C)=O.COCC(C)OC(C)=O.
What is the InChIKey of 1-methoxypropan-2-yl acetate;2-methoxypropyl acetate?
The InChIKey is NVNHYMZQUYNJCB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H12O3/c1-5(8-3)4-9-6(2)7;1-5(4-8-3)9-6(2)7/h2*5H,4H2,1-3H3.
What are the key properties of 1-methoxypropan-2-yl acetate;2-methoxypropyl acetate?
1-methoxypropan-2-yl acetate;2-methoxypropyl acetate has a molecular weight of 264.32 g/mol, XLogP of 1.17, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-yl acetate;2-methoxypropyl acetate is sourced from PubChem (CID 87233398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).