About 2-acetyloxypropyl acetate;propan-2-one
2-acetyloxypropyl acetate;propan-2-one (PubChem CID 159489239) has the molecular formula C10H18O5
and a molecular weight of 218.25 g/mol. Its IUPAC name is 2-acetyloxypropyl acetate;propan-2-one.
Molecular Properties
| Compound Name | 2-acetyloxypropyl acetate;propan-2-one |
| PubChem CID | 159489239 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-acetyloxypropyl acetate;propan-2-one |
| SMILES | CC(=O)OCC(C)OC(C)=O.CC(C)=O |
| InChI | InChI=1S/C7H12O4.C3H6O/c1-5(11-7(3)9)4-10-6(2)8;1-3(2)4/h5H,4H2,1-3H3;1-2H3 |
| InChIKey | LXYYJGJTHWKNEI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-acetyloxypropyl acetate;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxypropyl acetate;propan-2-one?
The IUPAC name of 2-acetyloxypropyl acetate;propan-2-one (CID 159489239) is 2-acetyloxypropyl acetate;propan-2-one.
What is the SMILES notation for 2-acetyloxypropyl acetate;propan-2-one?
The canonical SMILES for 2-acetyloxypropyl acetate;propan-2-one is CC(=O)OCC(C)OC(C)=O.CC(C)=O.
What is the InChIKey of 2-acetyloxypropyl acetate;propan-2-one?
The InChIKey is LXYYJGJTHWKNEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4.C3H6O/c1-5(11-7(3)9)4-10-6(2)8;1-3(2)4/h5H,4H2,1-3H3;1-2H3.
What are the key properties of 2-acetyloxypropyl acetate;propan-2-one?
2-acetyloxypropyl acetate;propan-2-one has a molecular weight of 218.25 g/mol, XLogP of 1.10, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxypropyl acetate;propan-2-one is sourced from PubChem (CID 159489239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).