About 4-O-(1-acetyloxyethyl) 1-O-(2-acetyloxypropyl) butanedioate
4-O-(1-acetyloxyethyl) 1-O-(2-acetyloxypropyl) butanedioate (PubChem CID 123883116) has the molecular formula C13H20O8
and a molecular weight of 304.30 g/mol. Its IUPAC name is 4-O-(1-acetyloxyethyl) 1-O-(2-acetyloxypropyl) butanedioate.
Molecular Properties
| Compound Name | 4-O-(1-acetyloxyethyl) 1-O-(2-acetyloxypropyl) butanedioate |
| PubChem CID | 123883116 |
| Molecular Formula | C13H20O8 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 4-O-(1-acetyloxyethyl) 1-O-(2-acetyloxypropyl) butanedioate |
| SMILES | CC(=O)OC(C)COC(=O)CCC(=O)OC(C)OC(C)=O |
| InChI | InChI=1S/C13H20O8/c1-8(19-9(2)14)7-18-12(16)5-6-13(17)21-11(4)20-10(3)15/h8,11H,5-7H2,1-4H3 |
| InChIKey | GLAKRIJNQKGOND-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(1-acetyloxyethyl) 1-O-(2-acetyloxypropyl) butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(1-acetyloxyethyl) 1-O-(2-acetyloxypropyl) butanedioate?
The IUPAC name of 4-O-(1-acetyloxyethyl) 1-O-(2-acetyloxypropyl) butanedioate (CID 123883116) is 4-O-(1-acetyloxyethyl) 1-O-(2-acetyloxypropyl) butanedioate.
What is the SMILES notation for 4-O-(1-acetyloxyethyl) 1-O-(2-acetyloxypropyl) butanedioate?
The canonical SMILES for 4-O-(1-acetyloxyethyl) 1-O-(2-acetyloxypropyl) butanedioate is CC(=O)OC(C)COC(=O)CCC(=O)OC(C)OC(C)=O.
What is the InChIKey of 4-O-(1-acetyloxyethyl) 1-O-(2-acetyloxypropyl) butanedioate?
The InChIKey is GLAKRIJNQKGOND-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O8/c1-8(19-9(2)14)7-18-12(16)5-6-13(17)21-11(4)20-10(3)15/h8,11H,5-7H2,1-4H3.
What are the key properties of 4-O-(1-acetyloxyethyl) 1-O-(2-acetyloxypropyl) butanedioate?
4-O-(1-acetyloxyethyl) 1-O-(2-acetyloxypropyl) butanedioate has a molecular weight of 304.30 g/mol, XLogP of 0.71, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(1-acetyloxyethyl) 1-O-(2-acetyloxypropyl) butanedioate is sourced from PubChem (CID 123883116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).