C8H12O4 — CID 87413306
1-acetyloxypropan-2-yl prop-2-enoate (PubChem CID 87413306) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is 1-acetyloxypropan-2-yl prop-2-enoate.
| Compound Name | 1-acetyloxypropan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 87413306 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 1-acetyloxypropan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)COC(C)=O |
| InChI | InChI=1S/C8H12O4/c1-4-8(10)12-6(2)5-11-7(3)9/h4,6H,1,5H2,2-3H3 |
| InChIKey | SGNIFSPYOHYEFH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|