C6H11O5P — CID 151009966
1-dihydroxyphosphanyloxypropan-2-yl prop-2-enoate (PubChem CID 151009966) has the molecular formula C6H11O5P and a molecular weight of 194.12 g/mol. Its IUPAC name is 1-dihydroxyphosphanyloxypropan-2-yl prop-2-enoate.
| Compound Name | 1-dihydroxyphosphanyloxypropan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 151009966 |
| Molecular Formula | C6H11O5P |
| Molecular Weight | 194.12 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 1-dihydroxyphosphanyloxypropan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)COP(O)O |
| InChI | InChI=1S/C6H11O5P/c1-3-6(7)11-5(2)4-10-12(8)9/h3,5,8-9H,1,4H2,2H3 |
| InChIKey | XIIDJAVQEGHNGL-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.12 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|