C12H22O4 — CID 20554752
1-(1-propoxypropan-2-yloxy)propan-2-yl prop-2-enoate (PubChem CID 20554752) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is 1-(1-propoxypropan-2-yloxy)propan-2-yl prop-2-enoate.
| Compound Name | 1-(1-propoxypropan-2-yloxy)propan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 20554752 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 1-(1-propoxypropan-2-yloxy)propan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)COC(C)COCCC |
| InChI | InChI=1S/C12H22O4/c1-5-7-14-8-10(3)15-9-11(4)16-12(13)6-2/h6,10-11H,2,5,7-9H2,1,3-4H3 |
| InChIKey | KLKREAPVPKHKQC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|