C24H40N2O11 — CID 153411308
2-[1-[2-[2-[2-(2-prop-2-enoyloxyethylcarbamoyloxy)propoxy]propoxy]propoxy]propan-2-yloxycarbonylamino]ethyl prop-2-enoate (PubChem CID 153411308) has the molecular formula C24H40N2O11 and a molecular weight of 532.59 g/mol. Its IUPAC name is 2-[1-[2-[2-[2-(2-prop-2-enoyloxyethylcarbamoyloxy)propoxy]propoxy]propoxy]propan-2-yloxycarbonylamino]ethyl prop-2-enoate.
| Compound Name | 2-[1-[2-[2-[2-(2-prop-2-enoyloxyethylcarbamoyloxy)propoxy]propoxy]propoxy]propan-2-yloxycarbonylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 153411308 |
| Molecular Formula | C24H40N2O11 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 2-[1-[2-[2-[2-(2-prop-2-enoyloxyethylcarbamoyloxy)propoxy]propoxy]propoxy]propan-2-yloxycarbonylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)OC(C)COCC(C)OCC(C)OCC(C)OC(=O)NCCOC(=O)C=C |
| InChI | InChI=1S/C24H40N2O11/c1-7-21(27)32-11-9-25-23(29)36-19(5)14-31-13-17(3)34-15-18(4)35-16-20(6)37-24(30)26-10-12-33-22(28)8-2/h7-8,17-20H,1-2,9-16H2,3-6H3,(H,25,29)(H,26,30) |
| InChIKey | BUMFWDVLNOSEQQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 156.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|