C12H20O4 — CID 59264341
2-prop-2-enoyloxypropyl 2,2-dimethylbutanoate (PubChem CID 59264341) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-prop-2-enoyloxypropyl 2,2-dimethylbutanoate.
| Compound Name | 2-prop-2-enoyloxypropyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59264341 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-prop-2-enoyloxypropyl 2,2-dimethylbutanoate |
| SMILES | C=CC(=O)OC(C)COC(=O)C(C)(C)CC |
| InChI | InChI=1S/C12H20O4/c1-6-10(13)16-9(3)8-15-11(14)12(4,5)7-2/h6,9H,1,7-8H2,2-5H3 |
| InChIKey | OOFUAETVHZPSPO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|