C23H38O10S — CID 158585155
1-(2,2-dimethylbutanoyloxy)propan-2-yl 3-[[2-(2,3-dihydroxypropylsulfanyl)acetyl]oxymethyl]-3-methyl-4-prop-2-enoyloxybutanoate (PubChem CID 158585155) has the molecular formula C23H38O10S and a molecular weight of 506.61 g/mol. Its IUPAC name is 1-(2,2-dimethylbutanoyloxy)propan-2-yl 3-[[2-(2,3-dihydroxypropylsulfanyl)acetyl]oxymethyl]-3-methyl-4-prop-2-enoyloxybutanoate.
| Compound Name | 1-(2,2-dimethylbutanoyloxy)propan-2-yl 3-[[2-(2,3-dihydroxypropylsulfanyl)acetyl]oxymethyl]-3-methyl-4-prop-2-enoyloxybutanoate |
|---|---|
| PubChem CID | 158585155 |
| Molecular Formula | C23H38O10S |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 1-(2,2-dimethylbutanoyloxy)propan-2-yl 3-[[2-(2,3-dihydroxypropylsulfanyl)acetyl]oxymethyl]-3-methyl-4-prop-2-enoyloxybutanoate |
| SMILES | C=CC(=O)OCC(C)(COC(=O)CSCC(O)CO)CC(=O)OC(C)COC(=O)C(C)(C)CC |
| InChI | InChI=1S/C23H38O10S/c1-7-18(26)31-14-23(6,15-32-20(28)13-34-12-17(25)10-24)9-19(27)33-16(3)11-30-21(29)22(4,5)8-2/h7,16-17,24-25H,1,8-15H2,2-6H3 |
| InChIKey | WGPVDYGYHNBQHH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|