C20H28O8 — CID 90842874
2,2-bis(prop-2-enoyloxymethyl)butyl 2,2-dimethyl-3-prop-2-enoyloxypropanoate (PubChem CID 90842874) has the molecular formula C20H28O8 and a molecular weight of 396.44 g/mol. Its IUPAC name is 2,2-bis(prop-2-enoyloxymethyl)butyl 2,2-dimethyl-3-prop-2-enoyloxypropanoate.
| Compound Name | 2,2-bis(prop-2-enoyloxymethyl)butyl 2,2-dimethyl-3-prop-2-enoyloxypropanoate |
|---|---|
| PubChem CID | 90842874 |
| Molecular Formula | C20H28O8 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2,2-bis(prop-2-enoyloxymethyl)butyl 2,2-dimethyl-3-prop-2-enoyloxypropanoate |
| SMILES | C=CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)C(C)(C)COC(=O)C=C |
| InChI | InChI=1S/C20H28O8/c1-7-15(21)25-11-19(5,6)18(24)28-14-20(10-4,12-26-16(22)8-2)13-27-17(23)9-3/h7-9H,1-3,10-14H2,4-6H3 |
| InChIKey | GDQPBWCJYXTPOV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|