C17H24BO8- — CID 161197836
boranuide;[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] prop-2-enoate (PubChem CID 161197836) has the molecular formula C17H24BO8- and a molecular weight of 367.18 g/mol. Its IUPAC name is boranuide;[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] prop-2-enoate.
| Compound Name | boranuide;[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] prop-2-enoate |
|---|---|
| PubChem CID | 161197836 |
| Molecular Formula | C17H24BO8- |
| Molecular Weight | 367.18 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | boranuide;[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C.[BH4-] |
| InChI | InChI=1S/C17H20O8.BH4/c1-5-13(18)22-9-17(10-23-14(19)6-2,11-24-15(20)7-3)12-25-16(21)8-4;/h5-8H,1-4,9-12H2;1H4/q;-1 |
| InChIKey | UUOUZYMCPRIHLU-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.18 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|