C18H21ClO9 — CID 59460256
[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-chloro-4-oxobutanoate (PubChem CID 59460256) has the molecular formula C18H21ClO9 and a molecular weight of 416.81 g/mol. Its IUPAC name is [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-chloro-4-oxobutanoate.
| Compound Name | [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-chloro-4-oxobutanoate |
|---|---|
| PubChem CID | 59460256 |
| Molecular Formula | C18H21ClO9 |
| Molecular Weight | 416.81 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-chloro-4-oxobutanoate |
| SMILES | C=CC(=O)OCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)CCC(=O)Cl |
| InChI | InChI=1S/C18H21ClO9/c1-4-14(21)25-9-18(10-26-15(22)5-2,11-27-16(23)6-3)12-28-17(24)8-7-13(19)20/h4-6H,1-3,7-12H2 |
| InChIKey | VJFQWOVDAMQHCL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.81 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|