C19H28N2O8 — CID 131736476
ethane-1,2-diamine;[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] prop-2-enoate (PubChem CID 131736476) has the molecular formula C19H28N2O8 and a molecular weight of 412.44 g/mol. Its IUPAC name is ethane-1,2-diamine;[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] prop-2-enoate.
| Compound Name | ethane-1,2-diamine;[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] prop-2-enoate |
|---|---|
| PubChem CID | 131736476 |
| Molecular Formula | C19H28N2O8 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | ethane-1,2-diamine;[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C.NCCN |
| InChI | InChI=1S/C17H20O8.C2H8N2/c1-5-13(18)22-9-17(10-23-14(19)6-2,11-24-15(20)7-3)12-25-16(21)8-4;3-1-2-4/h5-8H,1-4,9-12H2;1-4H2 |
| InChIKey | JYPQXQYEPWBTIB-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 157.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|