C14H14O8 — CID 19981602
2,2,2-tri(prop-2-enoyloxy)ethyl prop-2-enoate (PubChem CID 19981602) has the molecular formula C14H14O8 and a molecular weight of 310.26 g/mol. Its IUPAC name is 2,2,2-tri(prop-2-enoyloxy)ethyl prop-2-enoate.
| Compound Name | 2,2,2-tri(prop-2-enoyloxy)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 19981602 |
| Molecular Formula | C14H14O8 |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2,2,2-tri(prop-2-enoyloxy)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(OC(=O)C=C)(OC(=O)C=C)OC(=O)C=C |
| InChI | InChI=1S/C14H14O8/c1-5-10(15)19-9-14(20-11(16)6-2,21-12(17)7-3)22-13(18)8-4/h5-8H,1-4,9H2 |
| InChIKey | FCXUNVKOIASAHV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|