C14H32O5Si3 — CID 22677159
1,1,2-tris(trimethylsilyloxy)ethyl prop-2-enoate (PubChem CID 22677159) has the molecular formula C14H32O5Si3 and a molecular weight of 364.66 g/mol. Its IUPAC name is 1,1,2-tris(trimethylsilyloxy)ethyl prop-2-enoate.
| Compound Name | 1,1,2-tris(trimethylsilyloxy)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 22677159 |
| Molecular Formula | C14H32O5Si3 |
| Molecular Weight | 364.66 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1,1,2-tris(trimethylsilyloxy)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(CO[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H32O5Si3/c1-11-13(15)17-14(18-21(5,6)7,19-22(8,9)10)12-16-20(2,3)4/h11H,1,12H2,2-10H3 |
| InChIKey | WOQOYOSYMHEAOM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.66 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|