C13H29NO4Si2 — CID 175636430
N-[1-hydroxy-3-trimethylsilyloxy-2-(trimethylsilyloxymethyl)propan-2-yl]prop-2-enamide (PubChem CID 175636430) has the molecular formula C13H29NO4Si2 and a molecular weight of 319.55 g/mol. Its IUPAC name is N-[1-hydroxy-3-trimethylsilyloxy-2-(trimethylsilyloxymethyl)propan-2-yl]prop-2-enamide.
| Compound Name | N-[1-hydroxy-3-trimethylsilyloxy-2-(trimethylsilyloxymethyl)propan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 175636430 |
| Molecular Formula | C13H29NO4Si2 |
| Molecular Weight | 319.55 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-[1-hydroxy-3-trimethylsilyloxy-2-(trimethylsilyloxymethyl)propan-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC(CO)(CO[Si](C)(C)C)CO[Si](C)(C)C |
| InChI | InChI=1S/C13H29NO4Si2/c1-8-12(16)14-13(9-15,10-17-19(2,3)4)11-18-20(5,6)7/h8,15H,1,9-11H2,2-7H3,(H,14,16) |
| InChIKey | UQXOUSJGHDRSJA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.55 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|