C13H27NO4Si — CID 58085096
N-(2-methyl-1-triethoxysilylpropan-2-yl)prop-2-enamide (PubChem CID 58085096) has the molecular formula C13H27NO4Si and a molecular weight of 289.45 g/mol. Its IUPAC name is N-(2-methyl-1-triethoxysilylpropan-2-yl)prop-2-enamide.
| Compound Name | N-(2-methyl-1-triethoxysilylpropan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 58085096 |
| Molecular Formula | C13H27NO4Si |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-(2-methyl-1-triethoxysilylpropan-2-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC(C)(C)C[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C13H27NO4Si/c1-7-12(15)14-13(5,6)11-19(16-8-2,17-9-3)18-10-4/h7H,1,8-11H2,2-6H3,(H,14,15) |
| InChIKey | WNXQAYDVOYUKEY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|