C14H24N2O7S2 — CID 154084381
[2-methyl-2-(prop-2-enoylamino)propyl]sulfonyl 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate (PubChem CID 154084381) has the molecular formula C14H24N2O7S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is [2-methyl-2-(prop-2-enoylamino)propyl]sulfonyl 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate.
| Compound Name | [2-methyl-2-(prop-2-enoylamino)propyl]sulfonyl 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 154084381 |
| Molecular Formula | C14H24N2O7S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | [2-methyl-2-(prop-2-enoylamino)propyl]sulfonyl 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate |
| SMILES | C=CC(=O)NC(C)(C)CS(=O)(=O)OS(=O)(=O)CC(C)(C)NC(=O)C=C |
| InChI | InChI=1S/C14H24N2O7S2/c1-7-11(17)15-13(3,4)9-24(19,20)23-25(21,22)10-14(5,6)16-12(18)8-2/h7-8H,1-2,9-10H2,3-6H3,(H,15,17)(H,16,18) |
| InChIKey | GEPVYHWNRKEIOE-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|