About 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene
2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene (PubChem CID 157315544) has the molecular formula C10H19NO6S2
and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene.
Molecular Properties
| Compound Name | 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene |
| PubChem CID | 157315544 |
| Molecular Formula | C10H19NO6S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene |
| SMILES | C=CC(=O)NC(C)(C)CS(=O)(=O)O.C=CS(C)(=O)=O |
| InChI | InChI=1S/C7H13NO4S.C3H6O2S/c1-4-6(9)8-7(2,3)5-13(10,11)12;1-3-6(2,4)5/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12);3H,1H2,2H3 |
| InChIKey | BDNWSSHEKPZQOD-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene?
The IUPAC name of 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene (CID 157315544) is 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene.
What is the SMILES notation for 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene?
The canonical SMILES for 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene is C=CC(=O)NC(C)(C)CS(=O)(=O)O.C=CS(C)(=O)=O.
What is the InChIKey of 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene?
The InChIKey is BDNWSSHEKPZQOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4S.C3H6O2S/c1-4-6(9)8-7(2,3)5-13(10,11)12;1-3-6(2,4)5/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12);3H,1H2,2H3.
What are the key properties of 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene?
2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene has a molecular weight of 313.40 g/mol, XLogP of 0.13, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene is sourced from PubChem (CID 157315544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).