C10H19NO6S2 — CID 157315544
2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene (PubChem CID 157315544) has the molecular formula C10H19NO6S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene.
| Compound Name | 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene |
|---|---|
| PubChem CID | 157315544 |
| Molecular Formula | C10H19NO6S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;1-methylsulfonylethene |
| SMILES | C=CC(=O)NC(C)(C)CS(=O)(=O)O.C=CS(C)(=O)=O |
| InChI | InChI=1S/C7H13NO4S.C3H6O2S/c1-4-6(9)8-7(2,3)5-13(10,11)12;1-3-6(2,4)5/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12);3H,1H2,2H3 |
| InChIKey | BDNWSSHEKPZQOD-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|