C12H22N2O5S — CID 131740959
3-methylbut-2-enamide;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid (PubChem CID 131740959) has the molecular formula C12H22N2O5S and a molecular weight of 306.38 g/mol. Its IUPAC name is 3-methylbut-2-enamide;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid.
| Compound Name | 3-methylbut-2-enamide;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 131740959 |
| Molecular Formula | C12H22N2O5S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3-methylbut-2-enamide;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid |
| SMILES | C=CC(=O)NC(C)(C)CS(=O)(=O)O.CC(C)=CC(N)=O |
| InChI | InChI=1S/C7H13NO4S.C5H9NO/c1-4-6(9)8-7(2,3)5-13(10,11)12;1-4(2)3-5(6)7/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12);3H,1-2H3,(H2,6,7) |
| InChIKey | OLEQWJIVGLLBOY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|