About 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;dihydrate
2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;dihydrate (PubChem CID 141386572) has the molecular formula C7H17NO6S
and a molecular weight of 243.28 g/mol. Its IUPAC name is 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;dihydrate.
Molecular Properties
| Compound Name | 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;dihydrate |
| PubChem CID | 141386572 |
| Molecular Formula | C7H17NO6S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;dihydrate |
| SMILES | C=CC(=O)NC(C)(C)CS(=O)(=O)O.O.O |
| InChI | InChI=1S/C7H13NO4S.2H2O/c1-4-6(9)8-7(2,3)5-13(10,11)12;;/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12);2*1H2 |
| InChIKey | BSWGYYASFKZJFY-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 146.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;dihydrate?
The IUPAC name of 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;dihydrate (CID 141386572) is 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;dihydrate.
What is the SMILES notation for 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;dihydrate?
The canonical SMILES for 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;dihydrate is C=CC(=O)NC(C)(C)CS(=O)(=O)O.O.O.
What is the InChIKey of 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;dihydrate?
The InChIKey is BSWGYYASFKZJFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4S.2H2O/c1-4-6(9)8-7(2,3)5-13(10,11)12;;/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12);2*1H2.
What are the key properties of 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;dihydrate?
2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;dihydrate has a molecular weight of 243.28 g/mol, XLogP of -1.69, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;dihydrate is sourced from PubChem (CID 141386572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).