C10H19NO4S — CID 175545779
2,3,3-trimethyl-2-(prop-2-enoylamino)butane-1-sulfonic acid (PubChem CID 175545779) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is 2,3,3-trimethyl-2-(prop-2-enoylamino)butane-1-sulfonic acid.
| Compound Name | 2,3,3-trimethyl-2-(prop-2-enoylamino)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 175545779 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2,3,3-trimethyl-2-(prop-2-enoylamino)butane-1-sulfonic acid |
| SMILES | C=CC(=O)NC(C)(CS(=O)(=O)O)C(C)(C)C |
| InChI | InChI=1S/C10H19NO4S/c1-6-8(12)11-10(5,9(2,3)4)7-16(13,14)15/h6H,1,7H2,2-5H3,(H,11,12)(H,13,14,15) |
| InChIKey | RNFWJWUSHFWWLO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|