C10H19NO7S2 — CID 91155152
2-methyl-2-(prop-2-enoylamino)hexane-1,6-disulfonic acid (PubChem CID 91155152) has the molecular formula C10H19NO7S2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-methyl-2-(prop-2-enoylamino)hexane-1,6-disulfonic acid.
| Compound Name | 2-methyl-2-(prop-2-enoylamino)hexane-1,6-disulfonic acid |
|---|---|
| PubChem CID | 91155152 |
| Molecular Formula | C10H19NO7S2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-methyl-2-(prop-2-enoylamino)hexane-1,6-disulfonic acid |
| SMILES | C=CC(=O)NC(C)(CCCCS(=O)(=O)O)CS(=O)(=O)O |
| InChI | InChI=1S/C10H19NO7S2/c1-3-9(12)11-10(2,8-20(16,17)18)6-4-5-7-19(13,14)15/h3H,1,4-8H2,2H3,(H,11,12)(H,13,14,15)(H,16,17,18) |
| InChIKey | ICUSHHXBUPWOLI-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|