C11H23NO7S2 — CID 87377360
butane-1-sulfonic acid;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid (PubChem CID 87377360) has the molecular formula C11H23NO7S2 and a molecular weight of 345.44 g/mol. Its IUPAC name is butane-1-sulfonic acid;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid.
| Compound Name | butane-1-sulfonic acid;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 87377360 |
| Molecular Formula | C11H23NO7S2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | butane-1-sulfonic acid;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid |
| SMILES | C=CC(=O)NC(C)(C)CS(=O)(=O)O.CCCCS(=O)(=O)O |
| InChI | InChI=1S/C7H13NO4S.C4H10O3S/c1-4-6(9)8-7(2,3)5-13(10,11)12;1-2-3-4-8(5,6)7/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12);2-4H2,1H3,(H,5,6,7) |
| InChIKey | LAYQTRAWWIZCNI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|