C7H13NO4S — CID 175771055
deuterio 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate (PubChem CID 175771055) has the molecular formula C7H13NO4S and a molecular weight of 208.26 g/mol. Its IUPAC name is deuterio 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate.
| Compound Name | deuterio 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 175771055 |
| Molecular Formula | C7H13NO4S |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | deuterio 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate |
| SMILES | [2H]OS(=O)(=O)CC(C)(C)NC(=O)C=C |
| InChI | InChI=1S/C7H13NO4S/c1-4-6(9)8-7(2,3)5-13(10,11)12/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12)/i/hD |
| InChIKey | XHZPRMZZQOIPDS-DYCDLGHISA-N |
| XLogP | -0.05 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|