C11H24N2O4S — CID 15271536
2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate;tetramethylazanium (PubChem CID 15271536) has the molecular formula C11H24N2O4S and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate;tetramethylazanium.
| Compound Name | 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate;tetramethylazanium |
|---|---|
| PubChem CID | 15271536 |
| Molecular Formula | C11H24N2O4S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate;tetramethylazanium |
| SMILES | C=CC(=O)NC(C)(C)CS(=O)(=O)[O-].C[N+](C)(C)C |
| InChI | InChI=1S/C7H13NO4S.C4H12N/c1-4-6(9)8-7(2,3)5-13(10,11)12;1-5(2,3)4/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12);1-4H3/q;+1/p-1 |
| InChIKey | ULEGCMPSTSKQKY-UHFFFAOYSA-M |
| XLogP | -0.07 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|