C8H12LiNO3 — CID 175226947
lithium 3-methyl-3-(prop-2-enoylamino)butanoate (PubChem CID 175226947) has the molecular formula C8H12LiNO3 and a molecular weight of 177.13 g/mol. Its IUPAC name is lithium 3-methyl-3-(prop-2-enoylamino)butanoate.
| Compound Name | lithium 3-methyl-3-(prop-2-enoylamino)butanoate |
|---|---|
| PubChem CID | 175226947 |
| Molecular Formula | C8H12LiNO3 |
| Molecular Weight | 177.13 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | lithium 3-methyl-3-(prop-2-enoylamino)butanoate |
| SMILES | C=CC(=O)NC(C)(C)CC(=O)[O-].[Li+] |
| InChI | InChI=1S/C8H13NO3.Li/c1-4-6(10)9-8(2,3)5-7(11)12;/h4H,1,5H2,2-3H3,(H,9,10)(H,11,12);/q;+1/p-1 |
| InChIKey | AJVAXWPNGHAOQU-UHFFFAOYSA-M |
| XLogP | -3.79 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.13 |
| LogP ≤ 5 | -3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|