C7H10NO3- — CID 19018280
2-methyl-2-(prop-2-enoylamino)propanoate (PubChem CID 19018280) has the molecular formula C7H10NO3- and a molecular weight of 156.16 g/mol. Its IUPAC name is 2-methyl-2-(prop-2-enoylamino)propanoate.
| Compound Name | 2-methyl-2-(prop-2-enoylamino)propanoate |
|---|---|
| PubChem CID | 19018280 |
| Molecular Formula | C7H10NO3- |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 2-methyl-2-(prop-2-enoylamino)propanoate |
| SMILES | C=CC(=O)NC(C)(C)C(=O)[O-] |
| InChI | InChI=1S/C7H11NO3/c1-4-5(9)8-7(2,3)6(10)11/h4H,1H2,2-3H3,(H,8,9)(H,10,11)/p-1 |
| InChIKey | FPBFWDHYZMVTJD-UHFFFAOYSA-M |
| XLogP | -1.18 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|