C11H18N2O4 — CID 175096839
2-methylprop-2-enamide;2-methyl-2-(prop-2-enoylamino)propanoic acid (PubChem CID 175096839) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-methylprop-2-enamide;2-methyl-2-(prop-2-enoylamino)propanoic acid.
| Compound Name | 2-methylprop-2-enamide;2-methyl-2-(prop-2-enoylamino)propanoic acid |
|---|---|
| PubChem CID | 175096839 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-methylprop-2-enamide;2-methyl-2-(prop-2-enoylamino)propanoic acid |
| SMILES | C=C(C)C(N)=O.C=CC(=O)NC(C)(C)C(=O)O |
| InChI | InChI=1S/C7H11NO3.C4H7NO/c1-4-5(9)8-7(2,3)6(10)11;1-3(2)4(5)6/h4H,1H2,2-3H3,(H,8,9)(H,10,11);1H2,2H3,(H2,5,6) |
| InChIKey | AIPYPCRQQOGRNY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|