C11H20N2O5S — CID 174519235
2-methylprop-2-enamide;2-(prop-2-enoylamino)butane-2-sulfonic acid (PubChem CID 174519235) has the molecular formula C11H20N2O5S and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-methylprop-2-enamide;2-(prop-2-enoylamino)butane-2-sulfonic acid.
| Compound Name | 2-methylprop-2-enamide;2-(prop-2-enoylamino)butane-2-sulfonic acid |
|---|---|
| PubChem CID | 174519235 |
| Molecular Formula | C11H20N2O5S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-methylprop-2-enamide;2-(prop-2-enoylamino)butane-2-sulfonic acid |
| SMILES | C=C(C)C(N)=O.C=CC(=O)NC(C)(CC)S(=O)(=O)O |
| InChI | InChI=1S/C7H13NO4S.C4H7NO/c1-4-6(9)8-7(3,5-2)13(10,11)12;1-3(2)4(5)6/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12);1H2,2H3,(H2,5,6) |
| InChIKey | HBAFYLCRDPAQGZ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|