C10H18N2O4S — CID 174849605
2-methylprop-2-enamide;propane-1-sulfonic acid;prop-2-enenitrile (PubChem CID 174849605) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is 2-methylprop-2-enamide;propane-1-sulfonic acid;prop-2-enenitrile.
| Compound Name | 2-methylprop-2-enamide;propane-1-sulfonic acid;prop-2-enenitrile |
|---|---|
| PubChem CID | 174849605 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-methylprop-2-enamide;propane-1-sulfonic acid;prop-2-enenitrile |
| SMILES | C=C(C)C(N)=O.C=CC#N.CCCS(=O)(=O)O |
| InChI | InChI=1S/C4H7NO.C3H3N.C3H8O3S/c1-3(2)4(5)6;1-2-3-4;1-2-3-7(4,5)6/h1H2,2H3,(H2,5,6);2H,1H2;2-3H2,1H3,(H,4,5,6) |
| InChIKey | NYDMYWGQRORGPO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|